C19H18N2O3S — CID 135856685
(5R)-2-(4-ethoxyphenyl)imino-5-phenacyl-1,3-thiazolidin-4-one (PubChem CID 135856685) has the molecular formula C19H18N2O3S and a molecular weight of 354.43 g/mol. Its IUPAC name is (5R)-2-(4-ethoxyphenyl)imino-5-phenacyl-1,3-thiazolidin-4-one.
| Compound Name | (5R)-2-(4-ethoxyphenyl)imino-5-phenacyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135856685 |
| Molecular Formula | C19H18N2O3S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | (5R)-2-(4-ethoxyphenyl)imino-5-phenacyl-1,3-thiazolidin-4-one |
| SMILES | CCOc1ccc(/N=C2\NC(=O)[C@@H](CC(=O)c3ccccc3)S2)cc1 |
| InChI | InChI=1S/C19H18N2O3S/c1-2-24-15-10-8-14(9-11-15)20-19-21-18(23)17(25-19)12-16(22)13-6-4-3-5-7-13/h3-11,17H,2,12H2,1H3,(H,20,21,23)/t17-/m1/s1 |
| InChIKey | OZZFCCWEFAGBHN-QGZVFWFLSA-N |
| XLogP | 3.58 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|