C20H21N3O2S — CID 135856926
13-[(3-hydroxypiperidin-1-yl)methyl]-17-thia-12,14-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16),12-hexaen-15-one (PubChem CID 135856926) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is 13-[(3-hydroxypiperidin-1-yl)methyl]-17-thia-12,14-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16),12-hexaen-15-one.
| Compound Name | 13-[(3-hydroxypiperidin-1-yl)methyl]-17-thia-12,14-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16),12-hexaen-15-one |
|---|---|
| PubChem CID | 135856926 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 13-[(3-hydroxypiperidin-1-yl)methyl]-17-thia-12,14-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16),12-hexaen-15-one |
| SMILES | O=c1[nH]c(CN2CCCC(O)C2)nc2c3c(sc12)-c1ccccc1CC3 |
| InChI | InChI=1S/C20H21N3O2S/c24-13-5-3-9-23(10-13)11-16-21-17-15-8-7-12-4-1-2-6-14(12)18(15)26-19(17)20(25)22-16/h1-2,4,6,13,24H,3,5,7-11H2,(H,21,22,25) |
| InChIKey | YEGAHIBQDLMKMH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |