C22H21N3O5 — CID 135857202
3,5-bis[(E)-2-(4-hydroxy-3-methoxyphenyl)ethenyl]pyrazole-1-carboxamide (PubChem CID 135857202) has the molecular formula C22H21N3O5 and a molecular weight of 407.43 g/mol. Its IUPAC name is 3,5-bis[(E)-2-(4-hydroxy-3-methoxyphenyl)ethenyl]pyrazole-1-carboxamide.
| Compound Name | 3,5-bis[(E)-2-(4-hydroxy-3-methoxyphenyl)ethenyl]pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 135857202 |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 3,5-bis[(E)-2-(4-hydroxy-3-methoxyphenyl)ethenyl]pyrazole-1-carboxamide |
| SMILES | COc1cc(/C=C/c2cc(/C=C/c3ccc(O)c(OC)c3)n(C(N)=O)n2)ccc1O |
| InChI | InChI=1S/C22H21N3O5/c1-29-20-11-14(5-9-18(20)26)3-7-16-13-17(25(24-16)22(23)28)8-4-15-6-10-19(27)21(12-15)30-2/h3-13,26-27H,1-2H3,(H2,23,28)/b7-3+,8-4+ |
| InChIKey | HVTSVGLLJGNWME-FCXRPNKRSA-N |
| XLogP | 3.58 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |