C19H14ClF3N6O — CID 135857264
2-[5-(4-chlorophenyl)-4-hydroxy-2-(2,2,2-trifluoroethyl)pyrazol-3-yl]-3H-benzimidazole-5-carboximidamide (PubChem CID 135857264) has the molecular formula C19H14ClF3N6O and a molecular weight of 434.81 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)-4-hydroxy-2-(2,2,2-trifluoroethyl)pyrazol-3-yl]-3H-benzimidazole-5-carboximidamide.
| Compound Name | 2-[5-(4-chlorophenyl)-4-hydroxy-2-(2,2,2-trifluoroethyl)pyrazol-3-yl]-3H-benzimidazole-5-carboximidamide |
|---|---|
| PubChem CID | 135857264 |
| Molecular Formula | C19H14ClF3N6O |
| Molecular Weight | 434.81 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 2-[5-(4-chlorophenyl)-4-hydroxy-2-(2,2,2-trifluoroethyl)pyrazol-3-yl]-3H-benzimidazole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2nc(-c3c(O)c(-c4ccc(Cl)cc4)nn3CC(F)(F)F)[nH]c2c1 |
| InChI | InChI=1S/C19H14ClF3N6O/c20-11-4-1-9(2-5-11)14-16(30)15(29(28-14)8-19(21,22)23)18-26-12-6-3-10(17(24)25)7-13(12)27-18/h1-7,30H,8H2,(H3,24,25)(H,26,27) |
| InChIKey | SWSMPIZBFXKYSW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.81 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|