C20H17F3N6O2 — CID 135857393
N'-hydroxy-2-[4-hydroxy-5-(4-methylphenyl)-2-(2,2,2-trifluoroethyl)pyrazol-3-yl]-3H-benzimidazole-5-carboximidamide (PubChem CID 135857393) has the molecular formula C20H17F3N6O2 and a molecular weight of 430.39 g/mol. Its IUPAC name is N'-hydroxy-2-[4-hydroxy-5-(4-methylphenyl)-2-(2,2,2-trifluoroethyl)pyrazol-3-yl]-3H-benzimidazole-5-carboximidamide.
| Compound Name | N'-hydroxy-2-[4-hydroxy-5-(4-methylphenyl)-2-(2,2,2-trifluoroethyl)pyrazol-3-yl]-3H-benzimidazole-5-carboximidamide |
|---|---|
| PubChem CID | 135857393 |
| Molecular Formula | C20H17F3N6O2 |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | N'-hydroxy-2-[4-hydroxy-5-(4-methylphenyl)-2-(2,2,2-trifluoroethyl)pyrazol-3-yl]-3H-benzimidazole-5-carboximidamide |
| SMILES | Cc1ccc(-c2nn(CC(F)(F)F)c(-c3nc4ccc(/C(N)=N/O)cc4[nH]3)c2O)cc1 |
| InChI | InChI=1S/C20H17F3N6O2/c1-10-2-4-11(5-3-10)15-17(30)16(29(27-15)9-20(21,22)23)19-25-13-7-6-12(18(24)28-31)8-14(13)26-19/h2-8,30-31H,9H2,1H3,(H2,24,28)(H,25,26) |
| InChIKey | QSZOETZBMOJPHV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 125.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|