About (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate
(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 135857758) has the molecular formula C14H9BrN2O4S
and a molecular weight of 381.21 g/mol. Its IUPAC name is (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate.
Molecular Properties
| Compound Name | (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
| PubChem CID | 135857758 |
| Molecular Formula | C14H9BrN2O4S |
| Molecular Weight | 381.21 g/mol |
| Exact Mass | 379.95 |
| IUPAC Name | (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(Br)o1)OCc1nc2ccsc2c(=O)[nH]1 |
| InChI | InChI=1S/C14H9BrN2O4S/c15-10-3-1-8(21-10)2-4-12(18)20-7-11-16-9-5-6-22-13(9)14(19)17-11/h1-6H,7H2,(H,16,17,19)/b4-2+ |
| InChIKey | ZBYAFUVXGBOBGO-DUXPYHPUSA-N |
| XLogP | 3.10 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.21 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate?
The IUPAC name of (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate (CID 135857758) is (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate.
What is the SMILES notation for (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate?
The canonical SMILES for (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate is O=C(/C=C/c1ccc(Br)o1)OCc1nc2ccsc2c(=O)[nH]1.
What is the InChIKey of (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate?
The InChIKey is ZBYAFUVXGBOBGO-DUXPYHPUSA-N. The full InChI is InChI=1S/C14H9BrN2O4S/c15-10-3-1-8(21-10)2-4-12(18)20-7-11-16-9-5-6-22-13(9)14(19)17-11/h1-6H,7H2,(H,16,17,19)/b4-2+.
What are the key properties of (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate?
(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate has a molecular weight of 381.21 g/mol, XLogP of 3.10, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate is sourced from PubChem (CID 135857758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).