C16H16F3N3O2 — CID 135858040
(5S,7R)-5-(4-ethylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxylic acid (PubChem CID 135858040) has the molecular formula C16H16F3N3O2 and a molecular weight of 339.32 g/mol. Its IUPAC name is (5S,7R)-5-(4-ethylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxylic acid.
| Compound Name | (5S,7R)-5-(4-ethylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxylic acid |
|---|---|
| PubChem CID | 135858040 |
| Molecular Formula | C16H16F3N3O2 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | (5S,7R)-5-(4-ethylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxylic acid |
| SMILES | CCc1ccc([C@@H]2C[C@H](C(F)(F)F)n3nc(C(=O)O)cc3N2)cc1 |
| InChI | InChI=1S/C16H16F3N3O2/c1-2-9-3-5-10(6-4-9)11-7-13(16(17,18)19)22-14(20-11)8-12(21-22)15(23)24/h3-6,8,11,13,20H,2,7H2,1H3,(H,23,24)/t11-,13+/m0/s1 |
| InChIKey | GFBPCMJFMGYTKE-WCQYABFASA-N |
| XLogP | 3.80 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |