About 2-[(2E)-2-(1,3-diphenylpropylidene)hydrazinyl]-4-methyl-5-propyl-1H-pyrimidin-6-one
2-[(2E)-2-(1,3-diphenylpropylidene)hydrazinyl]-4-methyl-5-propyl-1H-pyrimidin-6-one (PubChem CID 135858151) has the molecular formula C23H26N4O
and a molecular weight of 374.49 g/mol. Its IUPAC name is 2-[(2E)-2-(1,3-diphenylpropylidene)hydrazinyl]-4-methyl-5-propyl-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-[(2E)-2-(1,3-diphenylpropylidene)hydrazinyl]-4-methyl-5-propyl-1H-pyrimidin-6-one |
| PubChem CID | 135858151 |
| Molecular Formula | C23H26N4O |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 2-[(2E)-2-(1,3-diphenylpropylidene)hydrazinyl]-4-methyl-5-propyl-1H-pyrimidin-6-one |
| SMILES | CCCc1c(C)nc(N/N=C(\CCc2ccccc2)c2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C23H26N4O/c1-3-10-20-17(2)24-23(25-22(20)28)27-26-21(19-13-8-5-9-14-19)16-15-18-11-6-4-7-12-18/h4-9,11-14H,3,10,15-16H2,1-2H3,(H2,24,25,27,28)/b26-21+ |
| InChIKey | GJEQCBVKFUKLSB-YYADALCUSA-N |
| XLogP | 4.48 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2E)-2-(1,3-diphenylpropylidene)hydrazinyl]-4-methyl-5-propyl-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2E)-2-(1,3-diphenylpropylidene)hydrazinyl]-4-methyl-5-propyl-1H-pyrimidin-6-one?
The IUPAC name of 2-[(2E)-2-(1,3-diphenylpropylidene)hydrazinyl]-4-methyl-5-propyl-1H-pyrimidin-6-one (CID 135858151) is 2-[(2E)-2-(1,3-diphenylpropylidene)hydrazinyl]-4-methyl-5-propyl-1H-pyrimidin-6-one.
What is the SMILES notation for 2-[(2E)-2-(1,3-diphenylpropylidene)hydrazinyl]-4-methyl-5-propyl-1H-pyrimidin-6-one?
The canonical SMILES for 2-[(2E)-2-(1,3-diphenylpropylidene)hydrazinyl]-4-methyl-5-propyl-1H-pyrimidin-6-one is CCCc1c(C)nc(N/N=C(\CCc2ccccc2)c2ccccc2)[nH]c1=O.
What is the InChIKey of 2-[(2E)-2-(1,3-diphenylpropylidene)hydrazinyl]-4-methyl-5-propyl-1H-pyrimidin-6-one?
The InChIKey is GJEQCBVKFUKLSB-YYADALCUSA-N. The full InChI is InChI=1S/C23H26N4O/c1-3-10-20-17(2)24-23(25-22(20)28)27-26-21(19-13-8-5-9-14-19)16-15-18-11-6-4-7-12-18/h4-9,11-14H,3,10,15-16H2,1-2H3,(H2,24,25,27,28)/b26-21+.
What are the key properties of 2-[(2E)-2-(1,3-diphenylpropylidene)hydrazinyl]-4-methyl-5-propyl-1H-pyrimidin-6-one?
2-[(2E)-2-(1,3-diphenylpropylidene)hydrazinyl]-4-methyl-5-propyl-1H-pyrimidin-6-one has a molecular weight of 374.49 g/mol, XLogP of 4.48, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2E)-2-(1,3-diphenylpropylidene)hydrazinyl]-4-methyl-5-propyl-1H-pyrimidin-6-one is sourced from PubChem (CID 135858151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).