C18H19ClN4 — CID 135858215
3-chloro-6-[2,2,3,3,5,5,6,6-octadeuterio-4-(trideuteriomethyl)piperazin-1-yl]-11H-benzo[b][1,4]benzodiazepine (PubChem CID 135858215) has the molecular formula C18H19ClN4 and a molecular weight of 337.90 g/mol. Its IUPAC name is 3-chloro-6-[2,2,3,3,5,5,6,6-octadeuterio-4-(trideuteriomethyl)piperazin-1-yl]-11H-benzo[b][1,4]benzodiazepine.
| Compound Name | 3-chloro-6-[2,2,3,3,5,5,6,6-octadeuterio-4-(trideuteriomethyl)piperazin-1-yl]-11H-benzo[b][1,4]benzodiazepine |
|---|---|
| PubChem CID | 135858215 |
| Molecular Formula | C18H19ClN4 |
| Molecular Weight | 337.90 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 3-chloro-6-[2,2,3,3,5,5,6,6-octadeuterio-4-(trideuteriomethyl)piperazin-1-yl]-11H-benzo[b][1,4]benzodiazepine |
| SMILES | [2H]C([2H])([2H])N1C([2H])([2H])C([2H])([2H])N(C2=Nc3cc(Cl)ccc3Nc3ccccc32)C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C18H19ClN4/c1-22-8-10-23(11-9-22)18-14-4-2-3-5-15(14)20-16-7-6-13(19)12-17(16)21-18/h2-7,12,20H,8-11H2,1H3/i1D3,8D2,9D2,10D2,11D2 |
| InChIKey | QZUDBNBUXVUHMW-JBHSRKMPSA-N |
| XLogP | 3.72 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.90 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |