C32H42N4O7 — CID 135858911
5-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-[8-(hydroxyamino)-8-oxooctyl]-4-[4-(morpholin-4-ylmethyl)phenyl]-1,2-oxazole-3-carboxamide (PubChem CID 135858911) has the molecular formula C32H42N4O7 and a molecular weight of 594.71 g/mol. Its IUPAC name is 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-[8-(hydroxyamino)-8-oxooctyl]-4-[4-(morpholin-4-ylmethyl)phenyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-[8-(hydroxyamino)-8-oxooctyl]-4-[4-(morpholin-4-ylmethyl)phenyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 135858911 |
| Molecular Formula | C32H42N4O7 |
| Molecular Weight | 594.71 g/mol |
| Exact Mass | 594.31 |
| IUPAC Name | 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-[8-(hydroxyamino)-8-oxooctyl]-4-[4-(morpholin-4-ylmethyl)phenyl]-1,2-oxazole-3-carboxamide |
| SMILES | CC(C)c1cc(-c2onc(C(=O)NCCCCCCCC(=O)NO)c2-c2ccc(CN3CCOCC3)cc2)c(O)cc1O |
| InChI | InChI=1S/C32H42N4O7/c1-21(2)24-18-25(27(38)19-26(24)37)31-29(23-11-9-22(10-12-23)20-36-14-16-42-17-15-36)30(35-43-31)32(40)33-13-7-5-3-4-6-8-28(39)34-41/h9-12,18-19,21,37-38,41H,3-8,13-17,20H2,1-2H3,(H,33,40)(H,34,39) |
| InChIKey | RUYGOXQBZBHSBB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 157.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.71 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|