C55H36N8O2S — CID 135860204
5-[4-[1-(benzenesulfonyl)indol-3-yl]phenyl]-10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin (PubChem CID 135860204) has the molecular formula C55H36N8O2S and a molecular weight of 873.01 g/mol. Its IUPAC name is 5-[4-[1-(benzenesulfonyl)indol-3-yl]phenyl]-10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin.
| Compound Name | 5-[4-[1-(benzenesulfonyl)indol-3-yl]phenyl]-10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135860204 |
| Molecular Formula | C55H36N8O2S |
| Molecular Weight | 873.01 g/mol |
| Exact Mass | 872.27 |
| IUPAC Name | 5-[4-[1-(benzenesulfonyl)indol-3-yl]phenyl]-10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin |
| SMILES | O=S(=O)(c1ccccc1)n1cc(-c2ccc(-c3c4nc(c(-c5ccncc5)c5ccc([nH]5)c(-c5ccncc5)c5nc(c(-c6ccncc6)c6ccc3[nH]6)C=C5)C=C4)cc2)c2ccccc21 |
| InChI | InChI=1S/C55H36N8O2S/c64-66(65,40-6-2-1-3-7-40)63-34-42(41-8-4-5-9-51(41)63)35-10-12-36(13-11-35)52-43-14-16-45(59-43)53(37-22-28-56-29-23-37)47-18-20-49(61-47)55(39-26-32-58-33-27-39)50-21-19-48(62-50)54(38-24-30-57-31-25-38)46-17-15-44(52)60-46/h1-34,59,62H/b52-43-,52-44-,53-45-,53-47-,54-46-,54-48-,55-49-,55-50- |
| InChIKey | RBDZHPBAEKWSHV-AVTQDQBTSA-N |
| XLogP | 12.37 |
| TPSA | 135.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.01 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |