C59H50N8+4 — CID 135860227
5-[5-(9,9-dimethylfluoren-2-yl)-1-methylpyridin-1-ium-3-yl]-10,15,20-tris(1-methylpyridin-1-ium-4-yl)-21,23-dihydroporphyrin (PubChem CID 135860227) has the molecular formula C59H50N8+4 and a molecular weight of 871.11 g/mol. Its IUPAC name is 5-[5-(9,9-dimethylfluoren-2-yl)-1-methylpyridin-1-ium-3-yl]-10,15,20-tris(1-methylpyridin-1-ium-4-yl)-21,23-dihydroporphyrin.
| Compound Name | 5-[5-(9,9-dimethylfluoren-2-yl)-1-methylpyridin-1-ium-3-yl]-10,15,20-tris(1-methylpyridin-1-ium-4-yl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135860227 |
| Molecular Formula | C59H50N8+4 |
| Molecular Weight | 871.11 g/mol |
| Exact Mass | 870.41 |
| IUPAC Name | 5-[5-(9,9-dimethylfluoren-2-yl)-1-methylpyridin-1-ium-3-yl]-10,15,20-tris(1-methylpyridin-1-ium-4-yl)-21,23-dihydroporphyrin |
| SMILES | C[n+]1ccc(-c2c3nc(c(-c4cc[n+](C)cc4)c4ccc([nH]4)c(-c4cc(-c5ccc6c(c5)C(C)(C)c5ccccc5-6)c[n+](C)c4)c4nc(c(-c5cc[n+](C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C59H49N8/c1-59(2)45-10-8-7-9-43(45)44-12-11-40(34-46(44)59)41-33-42(36-67(6)35-41)58-53-19-17-51(62-53)56(38-23-29-65(4)30-24-38)49-15-13-47(60-49)55(37-21-27-64(3)28-22-37)48-14-16-50(61-48)57(52-18-20-54(58)63-52)39-25-31-66(5)32-26-39/h7-36H,1-6H3,(H,60,61,62,63)/q+3/p+1/b55-47-,55-48-,56-49-,56-51-,57-50-,57-52-,58-53-,58-54- |
| InChIKey | VZFWBWVERKNGEZ-MXRZNNOWSA-O |
| XLogP | 10.59 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.11 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|