About 1-ethyl-5-(5-propylfuran-2-yl)-4H-imidazo[4,5-d]pyrazole
1-ethyl-5-(5-propylfuran-2-yl)-4H-imidazo[4,5-d]pyrazole (PubChem CID 135860401) has the molecular formula C13H16N4O
and a molecular weight of 244.30 g/mol. Its IUPAC name is 1-ethyl-5-(5-propylfuran-2-yl)-4H-imidazo[4,5-d]pyrazole.
Molecular Properties
| Compound Name | 1-ethyl-5-(5-propylfuran-2-yl)-4H-imidazo[4,5-d]pyrazole |
| PubChem CID | 135860401 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 1-ethyl-5-(5-propylfuran-2-yl)-4H-imidazo[4,5-d]pyrazole |
| SMILES | CCCc1ccc(-c2nc3c(cnn3CC)[nH]2)o1 |
| InChI | InChI=1S/C13H16N4O/c1-3-5-9-6-7-11(18-9)12-15-10-8-14-17(4-2)13(10)16-12/h6-8H,3-5H2,1-2H3,(H,15,16) |
| InChIKey | QCXRSEGGFATCCB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethyl-5-(5-propylfuran-2-yl)-4H-imidazo[4,5-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-5-(5-propylfuran-2-yl)-4H-imidazo[4,5-d]pyrazole?
The IUPAC name of 1-ethyl-5-(5-propylfuran-2-yl)-4H-imidazo[4,5-d]pyrazole (CID 135860401) is 1-ethyl-5-(5-propylfuran-2-yl)-4H-imidazo[4,5-d]pyrazole.
What is the SMILES notation for 1-ethyl-5-(5-propylfuran-2-yl)-4H-imidazo[4,5-d]pyrazole?
The canonical SMILES for 1-ethyl-5-(5-propylfuran-2-yl)-4H-imidazo[4,5-d]pyrazole is CCCc1ccc(-c2nc3c(cnn3CC)[nH]2)o1.
What is the InChIKey of 1-ethyl-5-(5-propylfuran-2-yl)-4H-imidazo[4,5-d]pyrazole?
The InChIKey is QCXRSEGGFATCCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O/c1-3-5-9-6-7-11(18-9)12-15-10-8-14-17(4-2)13(10)16-12/h6-8H,3-5H2,1-2H3,(H,15,16).
What are the key properties of 1-ethyl-5-(5-propylfuran-2-yl)-4H-imidazo[4,5-d]pyrazole?
1-ethyl-5-(5-propylfuran-2-yl)-4H-imidazo[4,5-d]pyrazole has a molecular weight of 244.30 g/mol, XLogP of 2.99, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-5-(5-propylfuran-2-yl)-4H-imidazo[4,5-d]pyrazole is sourced from PubChem (CID 135860401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).