C18H23ClN6O — CID 135861856
6-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135861856) has the molecular formula C18H23ClN6O and a molecular weight of 374.88 g/mol. Its IUPAC name is 6-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135861856 |
| Molecular Formula | C18H23ClN6O |
| Molecular Weight | 374.88 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 6-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | Cc1nn(C)c(Cl)c1CN1CCc2nc(C3=NCCCC3)[nH]c(=O)c2C1 |
| InChI | InChI=1S/C18H23ClN6O/c1-11-12(16(19)24(2)23-11)9-25-8-6-14-13(10-25)18(26)22-17(21-14)15-5-3-4-7-20-15/h3-10H2,1-2H3,(H,21,22,26) |
| InChIKey | ZKAMMTZRTZDOQG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 79.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.88 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |