C15H17F3N4O — CID 135862094
6-[(3,5-dimethyl-1H-pyrrol-2-yl)methyl]-2-(trifluoromethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135862094) has the molecular formula C15H17F3N4O and a molecular weight of 326.32 g/mol. Its IUPAC name is 6-[(3,5-dimethyl-1H-pyrrol-2-yl)methyl]-2-(trifluoromethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(3,5-dimethyl-1H-pyrrol-2-yl)methyl]-2-(trifluoromethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135862094 |
| Molecular Formula | C15H17F3N4O |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 6-[(3,5-dimethyl-1H-pyrrol-2-yl)methyl]-2-(trifluoromethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | Cc1cc(C)c(CN2CCc3nc(C(F)(F)F)[nH]c(=O)c3C2)[nH]1 |
| InChI | InChI=1S/C15H17F3N4O/c1-8-5-9(2)19-12(8)7-22-4-3-11-10(6-22)13(23)21-14(20-11)15(16,17)18/h5,19H,3-4,6-7H2,1-2H3,(H,20,21,23) |
| InChIKey | HTNNHJKQKLXQBQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 64.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |