C23H19FN4O3 — CID 135862225
2-(4-aminophenyl)-6-[(6-fluoro-4-oxochromen-3-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135862225) has the molecular formula C23H19FN4O3 and a molecular weight of 418.43 g/mol. Its IUPAC name is 2-(4-aminophenyl)-6-[(6-fluoro-4-oxochromen-3-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-(4-aminophenyl)-6-[(6-fluoro-4-oxochromen-3-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135862225 |
| Molecular Formula | C23H19FN4O3 |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 2-(4-aminophenyl)-6-[(6-fluoro-4-oxochromen-3-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | Nc1ccc(-c2nc3c(c(=O)[nH]2)CN(Cc2coc4ccc(F)cc4c2=O)CC3)cc1 |
| InChI | InChI=1S/C23H19FN4O3/c24-15-3-6-20-17(9-15)21(29)14(12-31-20)10-28-8-7-19-18(11-28)23(30)27-22(26-19)13-1-4-16(25)5-2-13/h1-6,9,12H,7-8,10-11,25H2,(H,26,27,30) |
| InChIKey | HURGMMQVQAYUHL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|