C16H19N5OS — CID 135862316
2-(2,3,4,5-tetrahydropyridin-6-yl)-6-(1,3-thiazol-2-ylmethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135862316) has the molecular formula C16H19N5OS and a molecular weight of 329.43 g/mol. Its IUPAC name is 2-(2,3,4,5-tetrahydropyridin-6-yl)-6-(1,3-thiazol-2-ylmethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-(2,3,4,5-tetrahydropyridin-6-yl)-6-(1,3-thiazol-2-ylmethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135862316 |
| Molecular Formula | C16H19N5OS |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 2-(2,3,4,5-tetrahydropyridin-6-yl)-6-(1,3-thiazol-2-ylmethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(C2=NCCCC2)nc2c1CN(Cc1nccs1)CC2 |
| InChI | InChI=1S/C16H19N5OS/c22-16-11-9-21(10-14-18-6-8-23-14)7-4-12(11)19-15(20-16)13-3-1-2-5-17-13/h6,8H,1-5,7,9-10H2,(H,19,20,22) |
| InChIKey | DJFDDJHROLHFBJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |