C17H15ClN2O — CID 135862875
5-chloro-N-[(1R)-2,3-dihydro-1H-inden-1-yl]-1,4-dihydro-3,1-benzoxazin-2-imine (PubChem CID 135862875) has the molecular formula C17H15ClN2O and a molecular weight of 298.77 g/mol. Its IUPAC name is 5-chloro-N-[(1R)-2,3-dihydro-1H-inden-1-yl]-1,4-dihydro-3,1-benzoxazin-2-imine.
| Compound Name | 5-chloro-N-[(1R)-2,3-dihydro-1H-inden-1-yl]-1,4-dihydro-3,1-benzoxazin-2-imine |
|---|---|
| PubChem CID | 135862875 |
| Molecular Formula | C17H15ClN2O |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 5-chloro-N-[(1R)-2,3-dihydro-1H-inden-1-yl]-1,4-dihydro-3,1-benzoxazin-2-imine |
| SMILES | Clc1cccc2c1CO/C(=N\[C@@H]1CCc3ccccc31)N2 |
| InChI | InChI=1S/C17H15ClN2O/c18-14-6-3-7-15-13(14)10-21-17(19-15)20-16-9-8-11-4-1-2-5-12(11)16/h1-7,16H,8-10H2,(H,19,20)/t16-/m1/s1 |
| InChIKey | MZSPUCISYOGZIO-MRXNPFEDSA-N |
| XLogP | 4.33 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|