C23H19FN2O — CID 135862878
N-[(1R)-2,3-dihydro-1H-inden-1-yl]-5-(4-fluorophenyl)-1,4-dihydro-3,1-benzoxazin-2-imine (PubChem CID 135862878) has the molecular formula C23H19FN2O and a molecular weight of 358.42 g/mol. Its IUPAC name is N-[(1R)-2,3-dihydro-1H-inden-1-yl]-5-(4-fluorophenyl)-1,4-dihydro-3,1-benzoxazin-2-imine.
| Compound Name | N-[(1R)-2,3-dihydro-1H-inden-1-yl]-5-(4-fluorophenyl)-1,4-dihydro-3,1-benzoxazin-2-imine |
|---|---|
| PubChem CID | 135862878 |
| Molecular Formula | C23H19FN2O |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-[(1R)-2,3-dihydro-1H-inden-1-yl]-5-(4-fluorophenyl)-1,4-dihydro-3,1-benzoxazin-2-imine |
| SMILES | Fc1ccc(-c2cccc3c2CO/C(=N\[C@@H]2CCc4ccccc42)N3)cc1 |
| InChI | InChI=1S/C23H19FN2O/c24-17-11-8-16(9-12-17)18-6-3-7-21-20(18)14-27-23(25-21)26-22-13-10-15-4-1-2-5-19(15)22/h1-9,11-12,22H,10,13-14H2,(H,25,26)/t22-/m1/s1 |
| InChIKey | JRPRHARELFBWOQ-JOCHJYFZSA-N |
| XLogP | 5.48 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|