C23H20FN3O — CID 135862879
2-[[(1R)-2,3-dihydro-1H-inden-1-yl]imino]-N-(4-fluorophenyl)-1,4-dihydro-3,1-benzoxazin-5-amine (PubChem CID 135862879) has the molecular formula C23H20FN3O and a molecular weight of 373.43 g/mol. Its IUPAC name is 2-[[(1R)-2,3-dihydro-1H-inden-1-yl]imino]-N-(4-fluorophenyl)-1,4-dihydro-3,1-benzoxazin-5-amine.
| Compound Name | 2-[[(1R)-2,3-dihydro-1H-inden-1-yl]imino]-N-(4-fluorophenyl)-1,4-dihydro-3,1-benzoxazin-5-amine |
|---|---|
| PubChem CID | 135862879 |
| Molecular Formula | C23H20FN3O |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 2-[[(1R)-2,3-dihydro-1H-inden-1-yl]imino]-N-(4-fluorophenyl)-1,4-dihydro-3,1-benzoxazin-5-amine |
| SMILES | Fc1ccc(Nc2cccc3c2CO/C(=N\[C@@H]2CCc4ccccc42)N3)cc1 |
| InChI | InChI=1S/C23H20FN3O/c24-16-9-11-17(12-10-16)25-20-6-3-7-21-19(20)14-28-23(26-21)27-22-13-8-15-4-1-2-5-18(15)22/h1-7,9-12,22,25H,8,13-14H2,(H,26,27)/t22-/m1/s1 |
| InChIKey | MZYMFSDPFNHUBY-JOCHJYFZSA-N |
| XLogP | 5.55 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|