C17H17N3O — CID 135862913
2-[[(1R)-2,3-dihydro-1H-inden-1-yl]imino]-1,4-dihydro-3,1-benzoxazin-5-amine (PubChem CID 135862913) has the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-[[(1R)-2,3-dihydro-1H-inden-1-yl]imino]-1,4-dihydro-3,1-benzoxazin-5-amine.
| Compound Name | 2-[[(1R)-2,3-dihydro-1H-inden-1-yl]imino]-1,4-dihydro-3,1-benzoxazin-5-amine |
|---|---|
| PubChem CID | 135862913 |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 2-[[(1R)-2,3-dihydro-1H-inden-1-yl]imino]-1,4-dihydro-3,1-benzoxazin-5-amine |
| SMILES | Nc1cccc2c1CO/C(=N\[C@@H]1CCc3ccccc31)N2 |
| InChI | InChI=1S/C17H17N3O/c18-14-6-3-7-15-13(14)10-21-17(19-15)20-16-9-8-11-4-1-2-5-12(11)16/h1-7,16H,8-10,18H2,(H,19,20)/t16-/m1/s1 |
| InChIKey | UKLXOKAMJGHJBC-MRXNPFEDSA-N |
| XLogP | 3.25 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|