C25H22ClN3O2 — CID 135862915
2-(4-chlorophenyl)-N-[2-[[(1R)-2,3-dihydro-1H-inden-1-yl]imino]-1,4-dihydro-3,1-benzoxazin-5-yl]acetamide (PubChem CID 135862915) has the molecular formula C25H22ClN3O2 and a molecular weight of 431.92 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[2-[[(1R)-2,3-dihydro-1H-inden-1-yl]imino]-1,4-dihydro-3,1-benzoxazin-5-yl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[2-[[(1R)-2,3-dihydro-1H-inden-1-yl]imino]-1,4-dihydro-3,1-benzoxazin-5-yl]acetamide |
|---|---|
| PubChem CID | 135862915 |
| Molecular Formula | C25H22ClN3O2 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[2-[[(1R)-2,3-dihydro-1H-inden-1-yl]imino]-1,4-dihydro-3,1-benzoxazin-5-yl]acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)Nc1cccc2c1CO/C(=N\[C@@H]1CCc3ccccc31)N2 |
| InChI | InChI=1S/C25H22ClN3O2/c26-18-11-8-16(9-12-18)14-24(30)27-21-6-3-7-22-20(21)15-31-25(28-22)29-23-13-10-17-4-1-2-5-19(17)23/h1-9,11-12,23H,10,13-15H2,(H,27,30)(H,28,29)/t23-/m1/s1 |
| InChIKey | BZJQUQZJRMACKI-HSZRJFAPSA-N |
| XLogP | 5.51 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|