C18H20F3N3O4 — CID 135863546
2-(trifluoromethyl)-7-[(2,4,5-trimethoxyphenyl)methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135863546) has the molecular formula C18H20F3N3O4 and a molecular weight of 399.37 g/mol. Its IUPAC name is 2-(trifluoromethyl)-7-[(2,4,5-trimethoxyphenyl)methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-(trifluoromethyl)-7-[(2,4,5-trimethoxyphenyl)methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135863546 |
| Molecular Formula | C18H20F3N3O4 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 2-(trifluoromethyl)-7-[(2,4,5-trimethoxyphenyl)methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | COc1cc(OC)c(OC)cc1CN1CCc2c(nc(C(F)(F)F)[nH]c2=O)C1 |
| InChI | InChI=1S/C18H20F3N3O4/c1-26-13-7-15(28-3)14(27-2)6-10(13)8-24-5-4-11-12(9-24)22-17(18(19,20)21)23-16(11)25/h6-7H,4-5,8-9H2,1-3H3,(H,22,23,25) |
| InChIKey | CKEMDPDUNVTMNA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |