C25H26F3N3O3 — CID 135863619
7-[(2,4-diethoxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135863619) has the molecular formula C25H26F3N3O3 and a molecular weight of 473.50 g/mol. Its IUPAC name is 7-[(2,4-diethoxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[(2,4-diethoxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135863619 |
| Molecular Formula | C25H26F3N3O3 |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 7-[(2,4-diethoxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | CCOc1ccc(CN2CCc3c(nc(-c4ccc(C(F)(F)F)cc4)[nH]c3=O)C2)c(OCC)c1 |
| InChI | InChI=1S/C25H26F3N3O3/c1-3-33-19-10-7-17(22(13-19)34-4-2)14-31-12-11-20-21(15-31)29-23(30-24(20)32)16-5-8-18(9-6-16)25(26,27)28/h5-10,13H,3-4,11-12,14-15H2,1-2H3,(H,29,30,32) |
| InChIKey | DKGBARBZOXXYCM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |