C19H22F3N3O3 — CID 135863626
7-[(2,4-diethoxyphenyl)methyl]-2-(trifluoromethyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135863626) has the molecular formula C19H22F3N3O3 and a molecular weight of 397.40 g/mol. Its IUPAC name is 7-[(2,4-diethoxyphenyl)methyl]-2-(trifluoromethyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[(2,4-diethoxyphenyl)methyl]-2-(trifluoromethyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135863626 |
| Molecular Formula | C19H22F3N3O3 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 7-[(2,4-diethoxyphenyl)methyl]-2-(trifluoromethyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | CCOc1ccc(CN2CCc3c(nc(C(F)(F)F)[nH]c3=O)C2)c(OCC)c1 |
| InChI | InChI=1S/C19H22F3N3O3/c1-3-27-13-6-5-12(16(9-13)28-4-2)10-25-8-7-14-15(11-25)23-18(19(20,21)22)24-17(14)26/h5-6,9H,3-4,7-8,10-11H2,1-2H3,(H,23,24,26) |
| InChIKey | PDZKMKWSASGHFE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |