C24H24F3N3O3 — CID 135863719
7-[(2,4-dimethoxy-6-methylphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135863719) has the molecular formula C24H24F3N3O3 and a molecular weight of 459.47 g/mol. Its IUPAC name is 7-[(2,4-dimethoxy-6-methylphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[(2,4-dimethoxy-6-methylphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135863719 |
| Molecular Formula | C24H24F3N3O3 |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 7-[(2,4-dimethoxy-6-methylphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | COc1cc(C)c(CN2CCc3c(nc(-c4ccc(C(F)(F)F)cc4)[nH]c3=O)C2)c(OC)c1 |
| InChI | InChI=1S/C24H24F3N3O3/c1-14-10-17(32-2)11-21(33-3)19(14)12-30-9-8-18-20(13-30)28-22(29-23(18)31)15-4-6-16(7-5-15)24(25,26)27/h4-7,10-11H,8-9,12-13H2,1-3H3,(H,28,29,31) |
| InChIKey | UZYGWCWZTZRMBI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |