C23H22F3N3O3 — CID 135863739
7-[(2,4-dimethoxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135863739) has the molecular formula C23H22F3N3O3 and a molecular weight of 445.44 g/mol. Its IUPAC name is 7-[(2,4-dimethoxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[(2,4-dimethoxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135863739 |
| Molecular Formula | C23H22F3N3O3 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 7-[(2,4-dimethoxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | COc1ccc(CN2CCc3c(nc(-c4ccc(C(F)(F)F)cc4)[nH]c3=O)C2)c(OC)c1 |
| InChI | InChI=1S/C23H22F3N3O3/c1-31-17-8-5-15(20(11-17)32-2)12-29-10-9-18-19(13-29)27-21(28-22(18)30)14-3-6-16(7-4-14)23(24,25)26/h3-8,11H,9-10,12-13H2,1-2H3,(H,27,28,30) |
| InChIKey | FUBDQSUXRARFRS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |