C21H31N3O — CID 135863937
2-cyclopropyl-7-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135863937) has the molecular formula C21H31N3O and a molecular weight of 341.50 g/mol. Its IUPAC name is 2-cyclopropyl-7-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-cyclopropyl-7-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135863937 |
| Molecular Formula | C21H31N3O |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | 2-cyclopropyl-7-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | CC1=C(CCN2CCc3c(nc(C4CC4)[nH]c3=O)C2)C(C)(C)CCC1 |
| InChI | InChI=1S/C21H31N3O/c1-14-5-4-10-21(2,3)17(14)9-12-24-11-8-16-18(13-24)22-19(15-6-7-15)23-20(16)25/h15H,4-13H2,1-3H3,(H,22,23,25) |
| InChIKey | HJWRKHMMYKKTNM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|