C22H18F5N3O2 — CID 135863979
7-[(2,6-difluoro-4-methoxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135863979) has the molecular formula C22H18F5N3O2 and a molecular weight of 451.40 g/mol. Its IUPAC name is 7-[(2,6-difluoro-4-methoxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[(2,6-difluoro-4-methoxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135863979 |
| Molecular Formula | C22H18F5N3O2 |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 7-[(2,6-difluoro-4-methoxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | COc1cc(F)c(CN2CCc3c(nc(-c4ccc(C(F)(F)F)cc4)[nH]c3=O)C2)c(F)c1 |
| InChI | InChI=1S/C22H18F5N3O2/c1-32-14-8-17(23)16(18(24)9-14)10-30-7-6-15-19(11-30)28-20(29-21(15)31)12-2-4-13(5-3-12)22(25,26)27/h2-5,8-9H,6-7,10-11H2,1H3,(H,28,29,31) |
| InChIKey | IFCQWHCTDYXKLM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |