C23H22F3N3O4 — CID 135864019
7-[(4-hydroxy-2,6-dimethoxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135864019) has the molecular formula C23H22F3N3O4 and a molecular weight of 461.44 g/mol. Its IUPAC name is 7-[(4-hydroxy-2,6-dimethoxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[(4-hydroxy-2,6-dimethoxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135864019 |
| Molecular Formula | C23H22F3N3O4 |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 7-[(4-hydroxy-2,6-dimethoxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | COc1cc(O)cc(OC)c1CN1CCc2c(nc(-c3ccc(C(F)(F)F)cc3)[nH]c2=O)C1 |
| InChI | InChI=1S/C23H22F3N3O4/c1-32-19-9-15(30)10-20(33-2)17(19)11-29-8-7-16-18(12-29)27-21(28-22(16)31)13-3-5-14(6-4-13)23(24,25)26/h3-6,9-10,30H,7-8,11-12H2,1-2H3,(H,27,28,31) |
| InChIKey | MZCVYRLNLKXFTM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 87.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |