C17H18F3N3O4 — CID 135864026
7-[(4-hydroxy-2,6-dimethoxyphenyl)methyl]-2-(trifluoromethyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135864026) has the molecular formula C17H18F3N3O4 and a molecular weight of 385.34 g/mol. Its IUPAC name is 7-[(4-hydroxy-2,6-dimethoxyphenyl)methyl]-2-(trifluoromethyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[(4-hydroxy-2,6-dimethoxyphenyl)methyl]-2-(trifluoromethyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135864026 |
| Molecular Formula | C17H18F3N3O4 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 7-[(4-hydroxy-2,6-dimethoxyphenyl)methyl]-2-(trifluoromethyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | COc1cc(O)cc(OC)c1CN1CCc2c(nc(C(F)(F)F)[nH]c2=O)C1 |
| InChI | InChI=1S/C17H18F3N3O4/c1-26-13-5-9(24)6-14(27-2)11(13)7-23-4-3-10-12(8-23)21-16(17(18,19)20)22-15(10)25/h5-6,24H,3-4,7-8H2,1-2H3,(H,21,22,25) |
| InChIKey | MGFMKBQVYWTTTC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 87.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |