C17H17Cl2N3O — CID 135864976
2-cyclopropyl-7-[(3,4-dichlorophenyl)methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135864976) has the molecular formula C17H17Cl2N3O and a molecular weight of 350.25 g/mol. Its IUPAC name is 2-cyclopropyl-7-[(3,4-dichlorophenyl)methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-cyclopropyl-7-[(3,4-dichlorophenyl)methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135864976 |
| Molecular Formula | C17H17Cl2N3O |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 2-cyclopropyl-7-[(3,4-dichlorophenyl)methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(C2CC2)nc2c1CCN(Cc1ccc(Cl)c(Cl)c1)C2 |
| InChI | InChI=1S/C17H17Cl2N3O/c18-13-4-1-10(7-14(13)19)8-22-6-5-12-15(9-22)20-16(11-2-3-11)21-17(12)23/h1,4,7,11H,2-3,5-6,8-9H2,(H,20,21,23) |
| InChIKey | BBQUYXMKCUPDRQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |