C21H16Cl2F3N3O2 — CID 135865157
7-[(3,5-dichloro-2-hydroxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135865157) has the molecular formula C21H16Cl2F3N3O2 and a molecular weight of 470.28 g/mol. Its IUPAC name is 7-[(3,5-dichloro-2-hydroxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[(3,5-dichloro-2-hydroxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135865157 |
| Molecular Formula | C21H16Cl2F3N3O2 |
| Molecular Weight | 470.28 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | 7-[(3,5-dichloro-2-hydroxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(-c2ccc(C(F)(F)F)cc2)nc2c1CCN(Cc1cc(Cl)cc(Cl)c1O)C2 |
| InChI | InChI=1S/C21H16Cl2F3N3O2/c22-14-7-12(18(30)16(23)8-14)9-29-6-5-15-17(10-29)27-19(28-20(15)31)11-1-3-13(4-2-11)21(24,25)26/h1-4,7-8,30H,5-6,9-10H2,(H,27,28,31) |
| InChIKey | BXAWNUYPBSXLCL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.28 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|