C23H21ClF3N3O3 — CID 135865357
7-[(3-chloro-4,5-dimethoxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135865357) has the molecular formula C23H21ClF3N3O3 and a molecular weight of 479.89 g/mol. Its IUPAC name is 7-[(3-chloro-4,5-dimethoxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[(3-chloro-4,5-dimethoxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135865357 |
| Molecular Formula | C23H21ClF3N3O3 |
| Molecular Weight | 479.89 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 7-[(3-chloro-4,5-dimethoxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | COc1cc(CN2CCc3c(nc(-c4ccc(C(F)(F)F)cc4)[nH]c3=O)C2)cc(Cl)c1OC |
| InChI | InChI=1S/C23H21ClF3N3O3/c1-32-19-10-13(9-17(24)20(19)33-2)11-30-8-7-16-18(12-30)28-21(29-22(16)31)14-3-5-15(6-4-14)23(25,26)27/h3-6,9-10H,7-8,11-12H2,1-2H3,(H,28,29,31) |
| InChIKey | ANAPQKZHBPJYKT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.89 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |