C10H11ClF3N3O — CID 135866066
7-(2-chloroethyl)-2-(trifluoromethyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135866066) has the molecular formula C10H11ClF3N3O and a molecular weight of 281.67 g/mol. Its IUPAC name is 7-(2-chloroethyl)-2-(trifluoromethyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-(2-chloroethyl)-2-(trifluoromethyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135866066 |
| Molecular Formula | C10H11ClF3N3O |
| Molecular Weight | 281.67 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 7-(2-chloroethyl)-2-(trifluoromethyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(C(F)(F)F)nc2c1CCN(CCCl)C2 |
| InChI | InChI=1S/C10H11ClF3N3O/c11-2-4-17-3-1-6-7(5-17)15-9(10(12,13)14)16-8(6)18/h1-5H2,(H,15,16,18) |
| InChIKey | KMFVOZWACGRHQE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.67 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|