C16H21Br2N3O2 — CID 135867498
(1S)-2,2-dibromo-N-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-1-methylcyclopropane-1-carboxamide (PubChem CID 135867498) has the molecular formula C16H21Br2N3O2 and a molecular weight of 447.17 g/mol. Its IUPAC name is (1S)-2,2-dibromo-N-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-1-methylcyclopropane-1-carboxamide.
| Compound Name | (1S)-2,2-dibromo-N-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 135867498 |
| Molecular Formula | C16H21Br2N3O2 |
| Molecular Weight | 447.17 g/mol |
| Exact Mass | 445.00 |
| IUPAC Name | (1S)-2,2-dibromo-N-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-1-methylcyclopropane-1-carboxamide |
| SMILES | CCN(CC)c1ccc(/C=N\NC(=O)[C@]2(C)CC2(Br)Br)c(O)c1 |
| InChI | InChI=1S/C16H21Br2N3O2/c1-4-21(5-2)12-7-6-11(13(22)8-12)9-19-20-14(23)15(3)10-16(15,17)18/h6-9,22H,4-5,10H2,1-3H3,(H,20,23)/b19-9-/t15-/m0/s1 |
| InChIKey | VZTWJTSLXJMIRL-VRKJEAOJSA-N |
| XLogP | 3.58 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.17 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|