C25H24N4O7 — CID 135867567
N-[(E)-(2-hydroxy-5-methoxyphenyl)methylideneamino]-4-[2-[(2E)-2-[(2-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]benzamide (PubChem CID 135867567) has the molecular formula C25H24N4O7 and a molecular weight of 492.49 g/mol. Its IUPAC name is N-[(E)-(2-hydroxy-5-methoxyphenyl)methylideneamino]-4-[2-[(2E)-2-[(2-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]benzamide.
| Compound Name | N-[(E)-(2-hydroxy-5-methoxyphenyl)methylideneamino]-4-[2-[(2E)-2-[(2-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 135867567 |
| Molecular Formula | C25H24N4O7 |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | N-[(E)-(2-hydroxy-5-methoxyphenyl)methylideneamino]-4-[2-[(2E)-2-[(2-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]benzamide |
| SMILES | COc1ccc(O)c(/C=N/NC(=O)COc2ccc(C(=O)N/N=C/c3cc(OC)ccc3O)cc2)c1 |
| InChI | InChI=1S/C25H24N4O7/c1-34-20-7-9-22(30)17(11-20)13-26-28-24(32)15-36-19-5-3-16(4-6-19)25(33)29-27-14-18-12-21(35-2)8-10-23(18)31/h3-14,30-31H,15H2,1-2H3,(H,28,32)(H,29,33)/b26-13+,27-14+ |
| InChIKey | APOKWPQPHDWFRF-BMNRKXRESA-N |
| XLogP | 2.41 |
| TPSA | 151.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|