About 4-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]-N-(2-phenylpyrazol-3-yl)benzenesulfonamide
4-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]-N-(2-phenylpyrazol-3-yl)benzenesulfonamide (PubChem CID 135867642) has the molecular formula C18H17N9O2S
and a molecular weight of 423.46 g/mol. Its IUPAC name is 4-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]-N-(2-phenylpyrazol-3-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]-N-(2-phenylpyrazol-3-yl)benzenesulfonamide |
| PubChem CID | 135867642 |
| Molecular Formula | C18H17N9O2S |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 4-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]-N-(2-phenylpyrazol-3-yl)benzenesulfonamide |
| SMILES | Nc1n[nH]c(N)c1/N=N/c1ccc(S(=O)(=O)Nc2ccnn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H17N9O2S/c19-17-16(18(20)25-24-17)23-22-12-6-8-14(9-7-12)30(28,29)26-15-10-11-21-27(15)13-4-2-1-3-5-13/h1-11,26H,(H5,19,20,24,25)/b23-22+ |
| InChIKey | KPLYMTUZLWFQRR-GHVJWSGMSA-N |
| XLogP | 2.98 |
| TPSA | 169.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]-N-(2-phenylpyrazol-3-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]-N-(2-phenylpyrazol-3-yl)benzenesulfonamide?
The IUPAC name of 4-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]-N-(2-phenylpyrazol-3-yl)benzenesulfonamide (CID 135867642) is 4-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]-N-(2-phenylpyrazol-3-yl)benzenesulfonamide.
What is the SMILES notation for 4-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]-N-(2-phenylpyrazol-3-yl)benzenesulfonamide?
The canonical SMILES for 4-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]-N-(2-phenylpyrazol-3-yl)benzenesulfonamide is Nc1n[nH]c(N)c1/N=N/c1ccc(S(=O)(=O)Nc2ccnn2-c2ccccc2)cc1.
What is the InChIKey of 4-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]-N-(2-phenylpyrazol-3-yl)benzenesulfonamide?
The InChIKey is KPLYMTUZLWFQRR-GHVJWSGMSA-N. The full InChI is InChI=1S/C18H17N9O2S/c19-17-16(18(20)25-24-17)23-22-12-6-8-14(9-7-12)30(28,29)26-15-10-11-21-27(15)13-4-2-1-3-5-13/h1-11,26H,(H5,19,20,24,25)/b23-22+.
What are the key properties of 4-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]-N-(2-phenylpyrazol-3-yl)benzenesulfonamide?
4-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]-N-(2-phenylpyrazol-3-yl)benzenesulfonamide has a molecular weight of 423.46 g/mol, XLogP of 2.98, 6 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]-N-(2-phenylpyrazol-3-yl)benzenesulfonamide is sourced from PubChem (CID 135867642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).