C16H8Br2F6N2O3 — CID 135867740
N-[(E)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 135867740) has the molecular formula C16H8Br2F6N2O3 and a molecular weight of 550.05 g/mol. Its IUPAC name is N-[(E)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[(E)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 135867740 |
| Molecular Formula | C16H8Br2F6N2O3 |
| Molecular Weight | 550.05 g/mol |
| Exact Mass | 547.88 |
| IUPAC Name | N-[(E)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C(N/N=C/c1cc(Br)c(O)c(Br)c1O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H8Br2F6N2O3/c17-10-3-7(12(27)11(18)13(10)28)5-25-26-14(29)6-1-8(15(19,20)21)4-9(2-6)16(22,23)24/h1-5,27-28H,(H,26,29)/b25-5+ |
| InChIKey | BHPSZHFOPFVKLN-VVAXDPKNSA-N |
| XLogP | 5.42 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.05 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|