C22H41N7O — CID 135867794
2-[8-(4-amino-2-oxo-1,3,5-triazacyclotridec-4-en-1-yl)octyl]-1-prop-2-ynylguanidine (PubChem CID 135867794) has the molecular formula C22H41N7O and a molecular weight of 419.62 g/mol. Its IUPAC name is 2-[8-(4-amino-2-oxo-1,3,5-triazacyclotridec-4-en-1-yl)octyl]-1-prop-2-ynylguanidine.
| Compound Name | 2-[8-(4-amino-2-oxo-1,3,5-triazacyclotridec-4-en-1-yl)octyl]-1-prop-2-ynylguanidine |
|---|---|
| PubChem CID | 135867794 |
| Molecular Formula | C22H41N7O |
| Molecular Weight | 419.62 g/mol |
| Exact Mass | 419.34 |
| IUPAC Name | 2-[8-(4-amino-2-oxo-1,3,5-triazacyclotridec-4-en-1-yl)octyl]-1-prop-2-ynylguanidine |
| SMILES | C#CCN/C(N)=N/CCCCCCCCN1CCCCCCCC/N=C(/N)NC1=O |
| InChI | InChI=1S/C22H41N7O/c1-2-15-25-20(23)26-16-11-7-3-5-9-13-18-29-19-14-10-6-4-8-12-17-27-21(24)28-22(29)30/h1H,3-19H2,(H3,23,25,26)(H3,24,27,28,30) |
| InChIKey | MDZMOHKTEJCXSR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.62 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|