C21H28N8S — CID 135867815
2-[(4-methylpiperazin-1-yl)methyl]-4-[(E)-(5-phenyl-1H-pyrazol-4-yl)methylideneamino]-5-propyl-1,2,4-triazole-3-thione (PubChem CID 135867815) has the molecular formula C21H28N8S and a molecular weight of 424.58 g/mol. Its IUPAC name is 2-[(4-methylpiperazin-1-yl)methyl]-4-[(E)-(5-phenyl-1H-pyrazol-4-yl)methylideneamino]-5-propyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[(4-methylpiperazin-1-yl)methyl]-4-[(E)-(5-phenyl-1H-pyrazol-4-yl)methylideneamino]-5-propyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 135867815 |
| Molecular Formula | C21H28N8S |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 2-[(4-methylpiperazin-1-yl)methyl]-4-[(E)-(5-phenyl-1H-pyrazol-4-yl)methylideneamino]-5-propyl-1,2,4-triazole-3-thione |
| SMILES | CCCc1nn(CN2CCN(C)CC2)c(=S)n1/N=C/c1cn[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C21H28N8S/c1-3-7-19-25-28(16-27-12-10-26(2)11-13-27)21(30)29(19)23-15-18-14-22-24-20(18)17-8-5-4-6-9-17/h4-6,8-9,14-15H,3,7,10-13,16H2,1-2H3,(H,22,24)/b23-15+ |
| InChIKey | ILDGTUBFCWGPNI-HZHRSRAPSA-N |
| XLogP | 2.84 |
| TPSA | 70.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|