C17H20N4O2 — CID 135868782
6-(3-oxo-3-piperidin-1-ylpropyl)-3-phenyl-4H-1,2,4-triazin-5-one (PubChem CID 135868782) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 6-(3-oxo-3-piperidin-1-ylpropyl)-3-phenyl-4H-1,2,4-triazin-5-one.
| Compound Name | 6-(3-oxo-3-piperidin-1-ylpropyl)-3-phenyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135868782 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 6-(3-oxo-3-piperidin-1-ylpropyl)-3-phenyl-4H-1,2,4-triazin-5-one |
| SMILES | O=C(CCc1nnc(-c2ccccc2)[nH]c1=O)N1CCCCC1 |
| InChI | InChI=1S/C17H20N4O2/c22-15(21-11-5-2-6-12-21)10-9-14-17(23)18-16(20-19-14)13-7-3-1-4-8-13/h1,3-4,7-8H,2,5-6,9-12H2,(H,18,20,23) |
| InChIKey | IRKNSGWUEVPDFU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |