C25H31N3O3S — CID 135869305
4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-[2-(4-methylphenyl)ethyl]piperidin-1-yl]butan-1-one (PubChem CID 135869305) has the molecular formula C25H31N3O3S and a molecular weight of 453.61 g/mol. Its IUPAC name is 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-[2-(4-methylphenyl)ethyl]piperidin-1-yl]butan-1-one.
| Compound Name | 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-[2-(4-methylphenyl)ethyl]piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 135869305 |
| Molecular Formula | C25H31N3O3S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-[4-[2-(4-methylphenyl)ethyl]piperidin-1-yl]butan-1-one |
| SMILES | Cc1ccc(CCC2CCN(C(=O)CCC/N=C3\NS(=O)(=O)c4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C25H31N3O3S/c1-19-8-10-20(11-9-19)12-13-21-14-17-28(18-15-21)24(29)7-4-16-26-25-22-5-2-3-6-23(22)32(30,31)27-25/h2-3,5-6,8-11,21H,4,7,12-18H2,1H3,(H,26,27) |
| InChIKey | ZFCHNMPDNPZREH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|