C46H33N5O4 — CID 135869413
2-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenoxy]ethyl nitrate (PubChem CID 135869413) has the molecular formula C46H33N5O4 and a molecular weight of 719.80 g/mol. Its IUPAC name is 2-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenoxy]ethyl nitrate.
| Compound Name | 2-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenoxy]ethyl nitrate |
|---|---|
| PubChem CID | 135869413 |
| Molecular Formula | C46H33N5O4 |
| Molecular Weight | 719.80 g/mol |
| Exact Mass | 719.25 |
| IUPAC Name | 2-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenoxy]ethyl nitrate |
| SMILES | O=[N+]([O-])OCCOc1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C46H33N5O4/c52-51(53)55-29-28-54-34-18-16-33(17-19-34)46-41-26-24-39(49-41)44(31-12-6-2-7-13-31)37-22-20-35(47-37)43(30-10-4-1-5-11-30)36-21-23-38(48-36)45(32-14-8-3-9-15-32)40-25-27-42(46)50-40/h1-27,47,50H,28-29H2/b43-35-,43-36-,44-37-,44-39-,45-38-,45-40-,46-41-,46-42- |
| InChIKey | JIMZKNCMPCFBFT-CRLDETFASA-N |
| XLogP | 10.91 |
| TPSA | 118.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.80 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|