C19H16N6O2 — CID 135869419
1-[4-[(4-oxo-5H-pyrazolo[3,4-d]pyrimidin-2-yl)methyl]phenyl]-3-phenylurea (PubChem CID 135869419) has the molecular formula C19H16N6O2 and a molecular weight of 360.38 g/mol. Its IUPAC name is 1-[4-[(4-oxo-5H-pyrazolo[3,4-d]pyrimidin-2-yl)methyl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[(4-oxo-5H-pyrazolo[3,4-d]pyrimidin-2-yl)methyl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 135869419 |
| Molecular Formula | C19H16N6O2 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 1-[4-[(4-oxo-5H-pyrazolo[3,4-d]pyrimidin-2-yl)methyl]phenyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(Cn2cc3c(=O)[nH]cnc3n2)cc1 |
| InChI | InChI=1S/C19H16N6O2/c26-18-16-11-25(24-17(16)20-12-21-18)10-13-6-8-15(9-7-13)23-19(27)22-14-4-2-1-3-5-14/h1-9,11-12H,10H2,(H2,22,23,27)(H,20,21,24,26) |
| InChIKey | BUCOGEJNJQHZOS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |