C18H18N4O2 — CID 135869648
5-(3-aminophenyl)-8-methyl-3-nitroso-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinolin-2-ol (PubChem CID 135869648) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 5-(3-aminophenyl)-8-methyl-3-nitroso-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinolin-2-ol.
| Compound Name | 5-(3-aminophenyl)-8-methyl-3-nitroso-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinolin-2-ol |
|---|---|
| PubChem CID | 135869648 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 5-(3-aminophenyl)-8-methyl-3-nitroso-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinolin-2-ol |
| SMILES | CN1CCc2c(-c3cccc(N)c3)cc3c(N=O)c(O)[nH]c3c2C1 |
| InChI | InChI=1S/C18H18N4O2/c1-22-6-5-12-13(10-3-2-4-11(19)7-10)8-14-16(15(12)9-22)20-18(23)17(14)21-24/h2-4,7-8,20,23H,5-6,9,19H2,1H3 |
| InChIKey | ZIXAHXFWHGMBSA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 94.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|