C27H26N8O3 — CID 135869753
1,3-bis[[4-(pyridin-3-ylcarbamoylamino)phenyl]methyl]urea (PubChem CID 135869753) has the molecular formula C27H26N8O3 and a molecular weight of 510.56 g/mol. Its IUPAC name is 1,3-bis[[4-(pyridin-3-ylcarbamoylamino)phenyl]methyl]urea.
| Compound Name | 1,3-bis[[4-(pyridin-3-ylcarbamoylamino)phenyl]methyl]urea |
|---|---|
| PubChem CID | 135869753 |
| Molecular Formula | C27H26N8O3 |
| Molecular Weight | 510.56 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | 1,3-bis[[4-(pyridin-3-ylcarbamoylamino)phenyl]methyl]urea |
| SMILES | O=C(NCc1ccc(NC(=O)Nc2cccnc2)cc1)NCc1ccc(NC(=O)Nc2cccnc2)cc1 |
| InChI | InChI=1S/C27H26N8O3/c36-25(30-15-19-5-9-21(10-6-19)32-26(37)34-23-3-1-13-28-17-23)31-16-20-7-11-22(12-8-20)33-27(38)35-24-4-2-14-29-18-24/h1-14,17-18H,15-16H2,(H2,30,31,36)(H2,32,34,37)(H2,33,35,38) |
| InChIKey | LGSNPPJKZSTIEG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 149.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |