About benzyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate
benzyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate (PubChem CID 135870934) has the molecular formula C18H18N2O4S
and a molecular weight of 358.42 g/mol. Its IUPAC name is benzyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate.
Molecular Properties
| Compound Name | benzyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate |
| PubChem CID | 135870934 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | benzyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate |
| SMILES | O=C(CCC/N=C1\NS(=O)(=O)c2ccccc21)OCc1ccccc1 |
| InChI | InChI=1S/C18H18N2O4S/c21-17(24-13-14-7-2-1-3-8-14)11-6-12-19-18-15-9-4-5-10-16(15)25(22,23)20-18/h1-5,7-10H,6,11-13H2,(H,19,20) |
| InChIKey | BGFGDGQMGSFZEH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze benzyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate?
The IUPAC name of benzyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate (CID 135870934) is benzyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate.
What is the SMILES notation for benzyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate?
The canonical SMILES for benzyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate is O=C(CCC/N=C1\NS(=O)(=O)c2ccccc21)OCc1ccccc1.
What is the InChIKey of benzyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate?
The InChIKey is BGFGDGQMGSFZEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O4S/c21-17(24-13-14-7-2-1-3-8-14)11-6-12-19-18-15-9-4-5-10-16(15)25(22,23)20-18/h1-5,7-10H,6,11-13H2,(H,19,20).
What are the key properties of benzyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate?
benzyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate has a molecular weight of 358.42 g/mol, XLogP of 2.25, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate is sourced from PubChem (CID 135870934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).