About (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanoate
(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanoate (PubChem CID 135870958) has the molecular formula C19H19N3O4S2
and a molecular weight of 417.51 g/mol. Its IUPAC name is (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanoate.
Molecular Properties
| Compound Name | (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanoate |
| PubChem CID | 135870958 |
| Molecular Formula | C19H19N3O4S2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanoate |
| SMILES | Cc1ccc(NC(=O)CSC(C)C(=O)OCc2nc3ccsc3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C19H19N3O4S2/c1-11-3-5-13(6-4-11)20-16(23)10-28-12(2)19(25)26-9-15-21-14-7-8-27-17(14)18(24)22-15/h3-8,12H,9-10H2,1-2H3,(H,20,23)(H,21,22,24) |
| InChIKey | OSODSIKWJHLTIO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanoate?
The IUPAC name of (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanoate (CID 135870958) is (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanoate.
What is the SMILES notation for (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanoate?
The canonical SMILES for (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanoate is Cc1ccc(NC(=O)CSC(C)C(=O)OCc2nc3ccsc3c(=O)[nH]2)cc1.
What is the InChIKey of (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanoate?
The InChIKey is OSODSIKWJHLTIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O4S2/c1-11-3-5-13(6-4-11)20-16(23)10-28-12(2)19(25)26-9-15-21-14-7-8-27-17(14)18(24)22-15/h3-8,12H,9-10H2,1-2H3,(H,20,23)(H,21,22,24).
What are the key properties of (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanoate?
(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanoate has a molecular weight of 417.51 g/mol, XLogP of 3.10, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanoate is sourced from PubChem (CID 135870958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).