C28H42N4O — CID 135871008
2-cyclohexylimino-3,5,19-triazatetracyclo[17.2.2.214,17.01,5]pentacosa-14,16,24-trien-4-one (PubChem CID 135871008) has the molecular formula C28H42N4O and a molecular weight of 450.67 g/mol. Its IUPAC name is 2-cyclohexylimino-3,5,19-triazatetracyclo[17.2.2.214,17.01,5]pentacosa-14,16,24-trien-4-one.
| Compound Name | 2-cyclohexylimino-3,5,19-triazatetracyclo[17.2.2.214,17.01,5]pentacosa-14,16,24-trien-4-one |
|---|---|
| PubChem CID | 135871008 |
| Molecular Formula | C28H42N4O |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.34 |
| IUPAC Name | 2-cyclohexylimino-3,5,19-triazatetracyclo[17.2.2.214,17.01,5]pentacosa-14,16,24-trien-4-one |
| SMILES | O=C1N/C(=N\C2CCCCC2)C23CCN(CC2)Cc2ccc(cc2)CCCCCCCCN13 |
| InChI | InChI=1S/C28H42N4O/c33-27-30-26(29-25-11-7-5-8-12-25)28-17-20-31(21-18-28)22-24-15-13-23(14-16-24)10-6-3-1-2-4-9-19-32(27)28/h13-16,25H,1-12,17-22H2,(H,29,30,33) |
| InChIKey | QUCKMGALAYJSCA-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|